About (2-bromo-4-methylphenyl) 2-fluorobenzoate
(2-bromo-4-methylphenyl) 2-fluorobenzoate (PubChem CID 23011824) has the molecular formula C14H10BrFO2
and a molecular weight of 309.13 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) 2-fluorobenzoate.
Molecular Properties
| Compound Name | (2-bromo-4-methylphenyl) 2-fluorobenzoate |
| PubChem CID | 23011824 |
| Molecular Formula | C14H10BrFO2 |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | (2-bromo-4-methylphenyl) 2-fluorobenzoate |
| SMILES | Cc1ccc(OC(=O)c2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C14H10BrFO2/c1-9-6-7-13(11(15)8-9)18-14(17)10-4-2-3-5-12(10)16/h2-8H,1H3 |
| InChIKey | WFTWCETXHUDDRG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-methylphenyl) 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-methylphenyl) 2-fluorobenzoate?
The IUPAC name of (2-bromo-4-methylphenyl) 2-fluorobenzoate (CID 23011824) is (2-bromo-4-methylphenyl) 2-fluorobenzoate.
What is the SMILES notation for (2-bromo-4-methylphenyl) 2-fluorobenzoate?
The canonical SMILES for (2-bromo-4-methylphenyl) 2-fluorobenzoate is Cc1ccc(OC(=O)c2ccccc2F)c(Br)c1.
What is the InChIKey of (2-bromo-4-methylphenyl) 2-fluorobenzoate?
The InChIKey is WFTWCETXHUDDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrFO2/c1-9-6-7-13(11(15)8-9)18-14(17)10-4-2-3-5-12(10)16/h2-8H,1H3.
What are the key properties of (2-bromo-4-methylphenyl) 2-fluorobenzoate?
(2-bromo-4-methylphenyl) 2-fluorobenzoate has a molecular weight of 309.13 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-methylphenyl) 2-fluorobenzoate is sourced from PubChem (CID 23011824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).