C9H18O4Si — CID 175874420
(2,3-dihydroxy-1-trimethylsilylpropyl) prop-2-enoate (PubChem CID 175874420) has the molecular formula C9H18O4Si and a molecular weight of 218.32 g/mol. Its IUPAC name is (2,3-dihydroxy-1-trimethylsilylpropyl) prop-2-enoate.
| Compound Name | (2,3-dihydroxy-1-trimethylsilylpropyl) prop-2-enoate |
|---|---|
| PubChem CID | 175874420 |
| Molecular Formula | C9H18O4Si |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2,3-dihydroxy-1-trimethylsilylpropyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(C(O)CO)[Si](C)(C)C |
| InChI | InChI=1S/C9H18O4Si/c1-5-8(12)13-9(7(11)6-10)14(2,3)4/h5,7,9-11H,1,6H2,2-4H3 |
| InChIKey | SHOJTHWMDDGTKB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|