C32H66O25 — CID 172699455
tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-propoxybutan-2-yl] prop-2-enoate;bis(prop-2-enoic acid) (PubChem CID 172699455) has the molecular formula C32H66O25 and a molecular weight of 850.85 g/mol. Its IUPAC name is tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-propoxybutan-2-yl] prop-2-enoate;bis(prop-2-enoic acid).
| Compound Name | tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-propoxybutan-2-yl] prop-2-enoate;bis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 172699455 |
| Molecular Formula | C32H66O25 |
| Molecular Weight | 850.85 g/mol |
| Exact Mass | 850.39 |
| IUPAC Name | tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-propoxybutan-2-yl] prop-2-enoate;bis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O[C@@H](CO)[C@@H](CO)OCCC.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H18O5.4C4H10O4.2C3H4O2/c1-3-5-14-8(6-11)9(7-12)15-10(13)4-2;4*5-1-3(7)4(8)2-6;2*1-2-3(4)5/h4,8-9,11-12H,2-3,5-7H2,1H3;4*3-8H,1-2H2;2*2H,1H2,(H,4,5)/t8-,9+;4*3-,4+;;/m1....../s1 |
| InChIKey | CTNPSQWXVZECRS-LAQKWKLZSA-N |
| XLogP | -8.85 |
| TPSA | 474.27 Ų |
| H-Bond Donors | 20 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.85 |
| LogP ≤ 5 | -8.85 |
| H-Bond Donors ≤ 5 | 20 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|