C18H44O8Si4 — CID 87223354
prop-2-enoic acid;3-propoxy-3-tris(trimethylsilyloxy)silylpropane-1,2-diol (PubChem CID 87223354) has the molecular formula C18H44O8Si4 and a molecular weight of 500.89 g/mol. Its IUPAC name is prop-2-enoic acid;3-propoxy-3-tris(trimethylsilyloxy)silylpropane-1,2-diol.
| Compound Name | prop-2-enoic acid;3-propoxy-3-tris(trimethylsilyloxy)silylpropane-1,2-diol |
|---|---|
| PubChem CID | 87223354 |
| Molecular Formula | C18H44O8Si4 |
| Molecular Weight | 500.89 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | prop-2-enoic acid;3-propoxy-3-tris(trimethylsilyloxy)silylpropane-1,2-diol |
| SMILES | C=CC(=O)O.CCCOC(C(O)CO)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H40O6Si4.C3H4O2/c1-11-12-18-15(14(17)13-16)25(19-22(2,3)4,20-23(5,6)7)21-24(8,9)10;1-2-3(4)5/h14-17H,11-13H2,1-10H3;2H,1H2,(H,4,5) |
| InChIKey | TWDPGUYGRQAOHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|