(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate

C10H14O7 — CID 141244199

IUPAC(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate
SMILESC=CC(=O)OOC(OC(=O)C=CC)C(O)CO
InChIInChI=1S/C10H14O7/c1-3-5-9(14)15-10(7(12)6-11)17-16-8(13)4-2/h3-5,7,10-12H,2,6H2,1H3
InChIKeyCQJXIHDEQXTIIO-UHFFFAOYSA-N
MW246.21 g/mol
LogP-0.55
Rot. Bonds7

About (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate

(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate (PubChem CID 141244199) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate.

Molecular Properties

Compound Name(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate
PubChem CID141244199
Molecular FormulaC10H14O7
Molecular Weight246.21 g/mol
Exact Mass246.07
IUPAC Name(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate
SMILESC=CC(=O)OOC(OC(=O)C=CC)C(O)CO
InChIInChI=1S/C10H14O7/c1-3-5-9(14)15-10(7(12)6-11)17-16-8(13)4-2/h3-5,7,10-12H,2,6H2,1H3
InChIKeyCQJXIHDEQXTIIO-UHFFFAOYSA-N
XLogP-0.55
TPSA102.29 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.21
LogP ≤ 5-0.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate?
The IUPAC name of (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate (CID 141244199) is (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate.
What is the SMILES notation for (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate?
The canonical SMILES for (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate is C=CC(=O)OOC(OC(=O)C=CC)C(O)CO.
What is the InChIKey of (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate?
The InChIKey is CQJXIHDEQXTIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O7/c1-3-5-9(14)15-10(7(12)6-11)17-16-8(13)4-2/h3-5,7,10-12H,2,6H2,1H3.
What are the key properties of (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate?
(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate has a molecular weight of 246.21 g/mol, XLogP of -0.55, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate is sourced from PubChem (CID 141244199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).