C10H14O7 — CID 141244199
(2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate (PubChem CID 141244199) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate.
| Compound Name | (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate |
|---|---|
| PubChem CID | 141244199 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (2,3-dihydroxy-1-prop-2-enoylperoxypropyl) but-2-enoate |
| SMILES | C=CC(=O)OOC(OC(=O)C=CC)C(O)CO |
| InChI | InChI=1S/C10H14O7/c1-3-5-9(14)15-10(7(12)6-11)17-16-8(13)4-2/h3-5,7,10-12H,2,6H2,1H3 |
| InChIKey | CQJXIHDEQXTIIO-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|