C12H19NO5 — CID 140984900
[2-(dimethylamino)-3-hydroxy-1-prop-2-enoyloxypropyl] 2-methylprop-2-enoate (PubChem CID 140984900) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is [2-(dimethylamino)-3-hydroxy-1-prop-2-enoyloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-(dimethylamino)-3-hydroxy-1-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140984900 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [2-(dimethylamino)-3-hydroxy-1-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC(OC(=O)C(=C)C)C(CO)N(C)C |
| InChI | InChI=1S/C12H19NO5/c1-6-10(15)17-12(9(7-14)13(4)5)18-11(16)8(2)3/h6,9,12,14H,1-2,7H2,3-5H3 |
| InChIKey | WPDFRRWNOAFBBF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|