C13H21NO4 — CID 140993462
[2-(diethylamino)-1-prop-2-enoyloxyethyl] 2-methylprop-2-enoate (PubChem CID 140993462) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is [2-(diethylamino)-1-prop-2-enoyloxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(diethylamino)-1-prop-2-enoyloxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140993462 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | [2-(diethylamino)-1-prop-2-enoyloxyethyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC(CN(CC)CC)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H21NO4/c1-6-11(15)17-12(9-14(7-2)8-3)18-13(16)10(4)5/h6,12H,1,4,7-9H2,2-3,5H3 |
| InChIKey | UJJKHWBEEVHJGC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|