C21H42Cl2N2O4 — CID 173494569
[ethyl(pentan-3-yl)amino] 2-methylprop-2-enoate;[ethyl(pentan-3-yl)amino] prop-2-enoate;dihydrochloride (PubChem CID 173494569) has the molecular formula C21H42Cl2N2O4 and a molecular weight of 457.48 g/mol. Its IUPAC name is [ethyl(pentan-3-yl)amino] 2-methylprop-2-enoate;[ethyl(pentan-3-yl)amino] prop-2-enoate;dihydrochloride.
| Compound Name | [ethyl(pentan-3-yl)amino] 2-methylprop-2-enoate;[ethyl(pentan-3-yl)amino] prop-2-enoate;dihydrochloride |
|---|---|
| PubChem CID | 173494569 |
| Molecular Formula | C21H42Cl2N2O4 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [ethyl(pentan-3-yl)amino] 2-methylprop-2-enoate;[ethyl(pentan-3-yl)amino] prop-2-enoate;dihydrochloride |
| SMILES | C=C(C)C(=O)ON(CC)C(CC)CC.C=CC(=O)ON(CC)C(CC)CC.Cl.Cl |
| InChI | InChI=1S/C11H21NO2.C10H19NO2.2ClH/c1-6-10(7-2)12(8-3)14-11(13)9(4)5;1-5-9(6-2)11(8-4)13-10(12)7-3;;/h10H,4,6-8H2,1-3,5H3;7,9H,3,5-6,8H2,1-2,4H3;2*1H |
| InChIKey | GRTQCCVWWZTJFD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|