C12H16O6 — CID 175368400
4-formylbenzoic acid;2-(2-hydroxyethoxy)ethanol (PubChem CID 175368400) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-formylbenzoic acid;2-(2-hydroxyethoxy)ethanol.
| Compound Name | 4-formylbenzoic acid;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 175368400 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-formylbenzoic acid;2-(2-hydroxyethoxy)ethanol |
| SMILES | O=Cc1ccc(C(=O)O)cc1.OCCOCCO |
| InChI | InChI=1S/C8H6O3.C4H10O3/c9-5-6-1-3-7(4-2-6)8(10)11;5-1-3-7-4-2-6/h1-5H,(H,10,11);5-6H,1-4H2 |
| InChIKey | XJWUGFDBQPXPBC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|