C18H24O11 — CID 174610219
2-acetyl-3-oxobutanoic acid;2-(2-hydroxyethoxy)ethanol;phthalic acid (PubChem CID 174610219) has the molecular formula C18H24O11 and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-acetyl-3-oxobutanoic acid;2-(2-hydroxyethoxy)ethanol;phthalic acid.
| Compound Name | 2-acetyl-3-oxobutanoic acid;2-(2-hydroxyethoxy)ethanol;phthalic acid |
|---|---|
| PubChem CID | 174610219 |
| Molecular Formula | C18H24O11 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-acetyl-3-oxobutanoic acid;2-(2-hydroxyethoxy)ethanol;phthalic acid |
| SMILES | CC(=O)C(C(C)=O)C(=O)O.O=C(O)c1ccccc1C(=O)O.OCCOCCO |
| InChI | InChI=1S/C8H6O4.C6H8O4.C4H10O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3(7)5(4(2)8)6(9)10;5-1-3-7-4-2-6/h1-4H,(H,9,10)(H,11,12);5H,1-2H3,(H,9,10);5-6H,1-4H2 |
| InChIKey | HMDCAXYYCDOWMI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 195.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|