C16H18O7 — CID 150668203
4-ethyl-3-(2-hydroxyethyl)-5-(2-methylprop-2-enoyloxy)phthalic acid (PubChem CID 150668203) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-ethyl-3-(2-hydroxyethyl)-5-(2-methylprop-2-enoyloxy)phthalic acid.
| Compound Name | 4-ethyl-3-(2-hydroxyethyl)-5-(2-methylprop-2-enoyloxy)phthalic acid |
|---|---|
| PubChem CID | 150668203 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-ethyl-3-(2-hydroxyethyl)-5-(2-methylprop-2-enoyloxy)phthalic acid |
| SMILES | C=C(C)C(=O)Oc1cc(C(=O)O)c(C(=O)O)c(CCO)c1CC |
| InChI | InChI=1S/C16H18O7/c1-4-9-10(5-6-17)13(15(20)21)11(14(18)19)7-12(9)23-16(22)8(2)3/h7,17H,2,4-6H2,1,3H3,(H,18,19)(H,20,21) |
| InChIKey | JFIAPHNGXJUTTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|