C14H14O6 — CID 159353007
2-ethyl-3-(2-methylprop-2-enoyloxy)terephthalic acid (PubChem CID 159353007) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-ethyl-3-(2-methylprop-2-enoyloxy)terephthalic acid.
| Compound Name | 2-ethyl-3-(2-methylprop-2-enoyloxy)terephthalic acid |
|---|---|
| PubChem CID | 159353007 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-ethyl-3-(2-methylprop-2-enoyloxy)terephthalic acid |
| SMILES | C=C(C)C(=O)Oc1c(C(=O)O)ccc(C(=O)O)c1CC |
| InChI | InChI=1S/C14H14O6/c1-4-8-9(12(15)16)5-6-10(13(17)18)11(8)20-14(19)7(2)3/h5-6H,2,4H2,1,3H3,(H,15,16)(H,17,18) |
| InChIKey | LHOJKVCPJYNFPT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|