C29H36O5 — CID 140767993
1-[4-[2-[4-[1-[1-(2-methylprop-2-enoyloxy)ethoxy]ethyl]phenyl]propan-2-yl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 140767993) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 1-[4-[2-[4-[1-[1-(2-methylprop-2-enoyloxy)ethoxy]ethyl]phenyl]propan-2-yl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[2-[4-[1-[1-(2-methylprop-2-enoyloxy)ethoxy]ethyl]phenyl]propan-2-yl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140767993 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 1-[4-[2-[4-[1-[1-(2-methylprop-2-enoyloxy)ethoxy]ethyl]phenyl]propan-2-yl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)OC(C)c1ccc(C(C)(C)c2ccc(C(C)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C29H36O5/c1-18(2)27(30)33-21(6)24-12-16-26(17-13-24)29(8,9)25-14-10-23(11-15-25)20(5)32-22(7)34-28(31)19(3)4/h10-17,20-22H,1,3H2,2,4-9H3 |
| InChIKey | YWSBTSMBCZZMIP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|