About 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate
1-(4-hydroxyphenyl)ethyl 2-oxopropanoate (PubChem CID 139681074) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate |
| PubChem CID | 139681074 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H12O4/c1-7(12)11(14)15-8(2)9-3-5-10(13)6-4-9/h3-6,8,13H,1-2H3 |
| InChIKey | CLKMRZBPYARQGV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate?
The IUPAC name of 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate (CID 139681074) is 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate.
What is the SMILES notation for 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate?
The canonical SMILES for 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate is CC(=O)C(=O)OC(C)c1ccc(O)cc1.
What is the InChIKey of 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate?
The InChIKey is CLKMRZBPYARQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-7(12)11(14)15-8(2)9-3-5-10(13)6-4-9/h3-6,8,13H,1-2H3.
What are the key properties of 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate?
1-(4-hydroxyphenyl)ethyl 2-oxopropanoate has a molecular weight of 208.21 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxyphenyl)ethyl 2-oxopropanoate is sourced from PubChem (CID 139681074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).