C16H30N2O — CID 159372563
2,6-diamino-2,6-dimethyl-5-phenylheptan-3-ol;methane (PubChem CID 159372563) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2,6-diamino-2,6-dimethyl-5-phenylheptan-3-ol;methane.
| Compound Name | 2,6-diamino-2,6-dimethyl-5-phenylheptan-3-ol;methane |
|---|---|
| PubChem CID | 159372563 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2,6-diamino-2,6-dimethyl-5-phenylheptan-3-ol;methane |
| SMILES | C.CC(C)(N)C(O)CC(c1ccccc1)C(C)(C)N |
| InChI | InChI=1S/C15H26N2O.CH4/c1-14(2,16)12(10-13(18)15(3,4)17)11-8-6-5-7-9-11;/h5-9,12-13,18H,10,16-17H2,1-4H3;1H4 |
| InChIKey | LJXPYNGPPWFQFQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |