C23H25N3O2 — CID 162407540
prop-2-ynyl 6-azido-2,2-dimethyl-4,6-diphenylhexanoate (PubChem CID 162407540) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is prop-2-ynyl 6-azido-2,2-dimethyl-4,6-diphenylhexanoate.
| Compound Name | prop-2-ynyl 6-azido-2,2-dimethyl-4,6-diphenylhexanoate |
|---|---|
| PubChem CID | 162407540 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | prop-2-ynyl 6-azido-2,2-dimethyl-4,6-diphenylhexanoate |
| SMILES | C#CCOC(=O)C(C)(C)CC(CC(N=[N+]=[N-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O2/c1-4-15-28-22(27)23(2,3)17-20(18-11-7-5-8-12-18)16-21(25-26-24)19-13-9-6-10-14-19/h1,5-14,20-21H,15-17H2,2-3H3 |
| InChIKey | VGLLPNSABACVHX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|