C28H44N2O5 — CID 144603465
aniline;2,3-dihydroxypropyl (Z)-7-(4-aminophenoxy)-2,2,3,3-tetramethylhept-4-enoate;ethane (PubChem CID 144603465) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is aniline;2,3-dihydroxypropyl (Z)-7-(4-aminophenoxy)-2,2,3,3-tetramethylhept-4-enoate;ethane.
| Compound Name | aniline;2,3-dihydroxypropyl (Z)-7-(4-aminophenoxy)-2,2,3,3-tetramethylhept-4-enoate;ethane |
|---|---|
| PubChem CID | 144603465 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | aniline;2,3-dihydroxypropyl (Z)-7-(4-aminophenoxy)-2,2,3,3-tetramethylhept-4-enoate;ethane |
| SMILES | CC.CC(C)(/C=C\CCOc1ccc(N)cc1)C(C)(C)C(=O)OCC(O)CO.Nc1ccccc1 |
| InChI | InChI=1S/C20H31NO5.C6H7N.C2H6/c1-19(2,20(3,4)18(24)26-14-16(23)13-22)11-5-6-12-25-17-9-7-15(21)8-10-17;7-6-4-2-1-3-5-6;1-2/h5,7-11,16,22-23H,6,12-14,21H2,1-4H3;1-5H,7H2;1-2H3/b11-5-;; |
| InChIKey | BTIULZKZPWSTTR-PHTSJKJYSA-N |
| XLogP | 4.84 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|