C19H26O6 — CID 118029470
[2-hydroxy-3-[3-(4-propan-2-yloxyphenyl)propanoyloxy]propyl] 2-methylprop-2-enoate (PubChem CID 118029470) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [2-hydroxy-3-[3-(4-propan-2-yloxyphenyl)propanoyloxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[3-(4-propan-2-yloxyphenyl)propanoyloxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118029470 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [2-hydroxy-3-[3-(4-propan-2-yloxyphenyl)propanoyloxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CCc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C19H26O6/c1-13(2)19(22)24-12-16(20)11-23-18(21)10-7-15-5-8-17(9-6-15)25-14(3)4/h5-6,8-9,14,16,20H,1,7,10-12H2,2-4H3 |
| InChIKey | PIQCNJXLEUGMGH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|