C22H34ClO5P — CID 172811755
triethyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxo-1-phenylpropyl]phosphanium chloride (PubChem CID 172811755) has the molecular formula C22H34ClO5P and a molecular weight of 444.94 g/mol. Its IUPAC name is triethyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxo-1-phenylpropyl]phosphanium chloride.
| Compound Name | triethyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxo-1-phenylpropyl]phosphanium chloride |
|---|---|
| PubChem CID | 172811755 |
| Molecular Formula | C22H34ClO5P |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | triethyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxo-1-phenylpropyl]phosphanium chloride |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CC(c1ccccc1)[P+](CC)(CC)CC.[Cl-] |
| InChI | InChI=1S/C22H34O5P.ClH/c1-6-28(7-2,8-3)20(18-12-10-9-11-13-18)14-21(24)26-15-19(23)16-27-22(25)17(4)5;/h9-13,19-20,23H,4,6-8,14-16H2,1-3,5H3;1H/q+1;/p-1 |
| InChIKey | SGQHPWOQFQOEQH-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|