C22H42O5Si4 — CID 148549656
[2-phenyl-3-tris(trimethylsilyloxy)silylpropyl] 2-methylprop-2-enoate (PubChem CID 148549656) has the molecular formula C22H42O5Si4 and a molecular weight of 498.92 g/mol. Its IUPAC name is [2-phenyl-3-tris(trimethylsilyloxy)silylpropyl] 2-methylprop-2-enoate.
| Compound Name | [2-phenyl-3-tris(trimethylsilyloxy)silylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 148549656 |
| Molecular Formula | C22H42O5Si4 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [2-phenyl-3-tris(trimethylsilyloxy)silylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H42O5Si4/c1-19(2)22(23)24-17-21(20-15-13-12-14-16-20)18-31(25-28(3,4)5,26-29(6,7)8)27-30(9,10)11/h12-16,21H,1,17-18H2,2-11H3 |
| InChIKey | XAVOLLCPMXSDHF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|