C25H32N2O3 — CID 54175342
[3-[4-(4-cyclohexylanilino)anilino]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 54175342) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [3-[4-(4-cyclohexylanilino)anilino]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-(4-cyclohexylanilino)anilino]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54175342 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [3-[4-(4-cyclohexylanilino)anilino]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNc1ccc(Nc2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-18(2)25(29)30-17-24(28)16-26-21-12-14-23(15-13-21)27-22-10-8-20(9-11-22)19-6-4-3-5-7-19/h8-15,19,24,26-28H,1,3-7,16-17H2,2H3 |
| InChIKey | OXXPYVJUNSDISF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|