C24H30N2O4 — CID 67483542
methyl 3-[[4-[(4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoate (PubChem CID 67483542) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 3-[[4-[(4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[[4-[(4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 67483542 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl 3-[[4-[(4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ccc(CNc2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-30-24(29)22(27)16-26-23(28)20-9-7-17(8-10-20)15-25-21-13-11-19(12-14-21)18-5-3-2-4-6-18/h7-14,18,22,25,27H,2-6,15-16H2,1H3,(H,26,28) |
| InChIKey | XXZLWLYFUPVHAM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |