C30H33NO5 — CID 87417840
methyl 4-[(4-cyclohexylanilino)methyl]benzoate;methyl 4-formylbenzoate (PubChem CID 87417840) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is methyl 4-[(4-cyclohexylanilino)methyl]benzoate;methyl 4-formylbenzoate.
| Compound Name | methyl 4-[(4-cyclohexylanilino)methyl]benzoate;methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 87417840 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | methyl 4-[(4-cyclohexylanilino)methyl]benzoate;methyl 4-formylbenzoate |
| SMILES | COC(=O)c1ccc(C=O)cc1.COC(=O)c1ccc(CNc2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H25NO2.C9H8O3/c1-24-21(23)19-9-7-16(8-10-19)15-22-20-13-11-18(12-14-20)17-5-3-2-4-6-17;1-12-9(11)8-4-2-7(6-10)3-5-8/h7-14,17,22H,2-6,15H2,1H3;2-6H,1H3 |
| InChIKey | XAIONAZJFNOYCS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|