C15H20O5 — CID 123341980
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 123341980) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-methylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-methylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 123341980 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C1C=C(C)C=CC1 |
| InChI | InChI=1S/C15H20O5/c1-10(2)14(17)19-8-13(16)9-20-15(18)12-6-4-5-11(3)7-12/h4-5,7,12-13,16H,1,6,8-9H2,2-3H3 |
| InChIKey | GLTKPDJOLVFXHK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|