C39H42O4 — CID 159509020
[4-(4-benzylphenyl)-2-hydroxybutyl] 2-methylprop-2-enoate;1-(4-benzylphenyl)-3-methylbut-3-en-2-one (PubChem CID 159509020) has the molecular formula C39H42O4 and a molecular weight of 574.76 g/mol. Its IUPAC name is [4-(4-benzylphenyl)-2-hydroxybutyl] 2-methylprop-2-enoate;1-(4-benzylphenyl)-3-methylbut-3-en-2-one.
| Compound Name | [4-(4-benzylphenyl)-2-hydroxybutyl] 2-methylprop-2-enoate;1-(4-benzylphenyl)-3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 159509020 |
| Molecular Formula | C39H42O4 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | [4-(4-benzylphenyl)-2-hydroxybutyl] 2-methylprop-2-enoate;1-(4-benzylphenyl)-3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(=O)Cc1ccc(Cc2ccccc2)cc1.C=C(C)C(=O)OCC(O)CCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O3.C18H18O/c1-16(2)21(23)24-15-20(22)13-12-17-8-10-19(11-9-17)14-18-6-4-3-5-7-18;1-14(2)18(19)13-17-10-8-16(9-11-17)12-15-6-4-3-5-7-15/h3-11,20,22H,1,12-15H2,2H3;3-11H,1,12-13H2,2H3 |
| InChIKey | MAJDZUNTKPNTED-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|