C29H59N5O11 — CID 166530462
2-[2-[2-[2-[bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethylcarbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 166530462) has the molecular formula C29H59N5O11 and a molecular weight of 653.82 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethylcarbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-[bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethylcarbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166530462 |
| Molecular Formula | C29H59N5O11 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.42 |
| IUPAC Name | 2-[2-[2-[2-[bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethylcarbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCOCCOCCN(CCOCCOCCOCCN)CCOCCOCCOCCN |
| InChI | InChI=1S/C29H59N5O11/c1-27(2)28(35)45-13-6-33-29(36)32-5-12-39-19-20-40-14-7-34(8-15-41-21-25-43-23-17-37-10-3-30)9-16-42-22-26-44-24-18-38-11-4-31/h1,3-26,30-31H2,2H3,(H2,32,33,36) |
| InChIKey | LNJTUAHPQOWDAP-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 196.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|