C19H33NO4S — CID 139469764
2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl (E)-4-ethyl-2-methylhex-2-enoate (PubChem CID 139469764) has the molecular formula C19H33NO4S and a molecular weight of 371.54 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl (E)-4-ethyl-2-methylhex-2-enoate.
| Compound Name | 2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl (E)-4-ethyl-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 139469764 |
| Molecular Formula | C19H33NO4S |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-[(4,4-dimethyl-3-oxopentyl)sulfanylcarbonylamino]ethyl (E)-4-ethyl-2-methylhex-2-enoate |
| SMILES | CCC(/C=C(\C)C(=O)OCCNC(=O)SCCC(=O)C(C)(C)C)CC |
| InChI | InChI=1S/C19H33NO4S/c1-7-15(8-2)13-14(3)17(22)24-11-10-20-18(23)25-12-9-16(21)19(4,5)6/h13,15H,7-12H2,1-6H3,(H,20,23)/b14-13+ |
| InChIKey | QSIAPAQSVLYJAD-BUHFOSPRSA-N |
| XLogP | 4.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|