About 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide
2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide (PubChem CID 87103475) has the molecular formula C15H26N2O4S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide |
| PubChem CID | 87103475 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide |
| SMILES | CC(=O)CCNC(=O)CC(SCCC(=O)C(C)(C)C)C(N)=O |
| InChI | InChI=1S/C15H26N2O4S/c1-10(18)5-7-17-13(20)9-11(14(16)21)22-8-6-12(19)15(2,3)4/h11H,5-9H2,1-4H3,(H2,16,21)(H,17,20) |
| InChIKey | FWYPBOSTFLFJFR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide?
The IUPAC name of 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide (CID 87103475) is 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide.
What is the SMILES notation for 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide?
The canonical SMILES for 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide is CC(=O)CCNC(=O)CC(SCCC(=O)C(C)(C)C)C(N)=O.
What is the InChIKey of 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide?
The InChIKey is FWYPBOSTFLFJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O4S/c1-10(18)5-7-17-13(20)9-11(14(16)21)22-8-6-12(19)15(2,3)4/h11H,5-9H2,1-4H3,(H2,16,21)(H,17,20).
What are the key properties of 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide?
2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide has a molecular weight of 330.45 g/mol, XLogP of 1.06, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-3-oxopentyl)sulfanyl-N'-(3-oxobutyl)butanediamide is sourced from PubChem (CID 87103475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).