C23H48N2O5S — CID 178008011
ethane;N'-[2-(2-methylpropoxy)ethyl]-2-(3-oxobutylsulfanyl)-N-(2-propoxyethyl)butanediamide (PubChem CID 178008011) has the molecular formula C23H48N2O5S and a molecular weight of 464.71 g/mol. Its IUPAC name is ethane;N'-[2-(2-methylpropoxy)ethyl]-2-(3-oxobutylsulfanyl)-N-(2-propoxyethyl)butanediamide.
| Compound Name | ethane;N'-[2-(2-methylpropoxy)ethyl]-2-(3-oxobutylsulfanyl)-N-(2-propoxyethyl)butanediamide |
|---|---|
| PubChem CID | 178008011 |
| Molecular Formula | C23H48N2O5S |
| Molecular Weight | 464.71 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | ethane;N'-[2-(2-methylpropoxy)ethyl]-2-(3-oxobutylsulfanyl)-N-(2-propoxyethyl)butanediamide |
| SMILES | CC.CC.CCCOCCNC(=O)C(CC(=O)NCCOCC(C)C)SCCC(C)=O |
| InChI | InChI=1S/C19H36N2O5S.2C2H6/c1-5-9-25-10-8-21-19(24)17(27-12-6-16(4)22)13-18(23)20-7-11-26-14-15(2)3;2*1-2/h15,17H,5-14H2,1-4H3,(H,20,23)(H,21,24);2*1-2H3 |
| InChIKey | POJZGZYLZUCHNC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|