C16H32N4O4 — CID 91198977
2-amino-6-(propanoylamino)hexanamide;N-(3-oxobutyl)propanamide (PubChem CID 91198977) has the molecular formula C16H32N4O4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-amino-6-(propanoylamino)hexanamide;N-(3-oxobutyl)propanamide.
| Compound Name | 2-amino-6-(propanoylamino)hexanamide;N-(3-oxobutyl)propanamide |
|---|---|
| PubChem CID | 91198977 |
| Molecular Formula | C16H32N4O4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-amino-6-(propanoylamino)hexanamide;N-(3-oxobutyl)propanamide |
| SMILES | CCC(=O)NCCC(C)=O.CCC(=O)NCCCCC(N)C(N)=O |
| InChI | InChI=1S/C9H19N3O2.C7H13NO2/c1-2-8(13)12-6-4-3-5-7(10)9(11)14;1-3-7(10)8-5-4-6(2)9/h7H,2-6,10H2,1H3,(H2,11,14)(H,12,13);3-5H2,1-2H3,(H,8,10) |
| InChIKey | UDOCGEWRJBZOJS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|