C19H31N3O5S — CID 58875509
2-[3-[4-formamido-2-(2-oxopyrrolidin-1-yl)pentyl]sulfanylpropanoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 58875509) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[3-[4-formamido-2-(2-oxopyrrolidin-1-yl)pentyl]sulfanylpropanoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[4-formamido-2-(2-oxopyrrolidin-1-yl)pentyl]sulfanylpropanoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58875509 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[3-[4-formamido-2-(2-oxopyrrolidin-1-yl)pentyl]sulfanylpropanoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)CCSCC(CC(C)NC=O)N1CCCC1=O |
| InChI | InChI=1S/C19H31N3O5S/c1-14(2)19(26)27-9-7-20-17(24)6-10-28-12-16(11-15(3)21-13-23)22-8-4-5-18(22)25/h13,15-16H,1,4-12H2,2-3H3,(H,20,24)(H,21,23) |
| InChIKey | OUWPXXACPFETAP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|