C16H26N2O6S — CID 58875549
2-[3-(2-carbamoyl-4-formamidopentyl)sulfanylpropanoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 58875549) has the molecular formula C16H26N2O6S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[3-(2-carbamoyl-4-formamidopentyl)sulfanylpropanoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(2-carbamoyl-4-formamidopentyl)sulfanylpropanoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58875549 |
| Molecular Formula | C16H26N2O6S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[3-(2-carbamoyl-4-formamidopentyl)sulfanylpropanoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCSCC(CC(C)NC=O)C(N)=O |
| InChI | InChI=1S/C16H26N2O6S/c1-11(2)16(22)24-6-5-23-14(20)4-7-25-9-13(15(17)21)8-12(3)18-10-19/h10,12-13H,1,4-9H2,2-3H3,(H2,17,21)(H,18,19) |
| InChIKey | WUKOSLPAKZUDIH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|