C18H30N2O6S — CID 59685866
2-[3-(2,4-diacetamidopentylsulfanyl)propanoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 59685866) has the molecular formula C18H30N2O6S and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-[3-(2,4-diacetamidopentylsulfanyl)propanoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(2,4-diacetamidopentylsulfanyl)propanoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59685866 |
| Molecular Formula | C18H30N2O6S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[3-(2,4-diacetamidopentylsulfanyl)propanoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCSCC(CC(C)NC(C)=O)NC(C)=O |
| InChI | InChI=1S/C18H30N2O6S/c1-12(2)18(24)26-8-7-25-17(23)6-9-27-11-16(20-15(5)22)10-13(3)19-14(4)21/h13,16H,1,6-11H2,2-5H3,(H,19,21)(H,20,22) |
| InChIKey | HRKFWEORBVQNOR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|