C29H44O6 — CID 101150216
1-O-(1-adamantyl) 3-O,3-O-ditert-butyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate (PubChem CID 101150216) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 1-O-(1-adamantyl) 3-O,3-O-ditert-butyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate.
| Compound Name | 1-O-(1-adamantyl) 3-O,3-O-ditert-butyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate |
|---|---|
| PubChem CID | 101150216 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 1-O-(1-adamantyl) 3-O,3-O-ditert-butyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate |
| SMILES | C=C(C)CC(CC(=C)C(=O)OC12CC3CC(CC(C3)C1)C2)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H44O6/c1-18(2)13-29(24(31)34-26(4,5)6,25(32)35-27(7,8)9)14-19(3)23(30)33-28-15-20-10-21(16-28)12-22(11-20)17-28/h20-22H,1,3,10-17H2,2,4-9H3 |
| InChIKey | SLGBMDDWWLDOIH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|