C17H21F9O2 — CID 58820959
1,1,1,3,3,3-hexafluoro-2-[3-(2,3,3-trifluorobutan-2-yloxy)-1-adamantyl]propan-2-ol (PubChem CID 58820959) has the molecular formula C17H21F9O2 and a molecular weight of 428.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-(2,3,3-trifluorobutan-2-yloxy)-1-adamantyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-(2,3,3-trifluorobutan-2-yloxy)-1-adamantyl]propan-2-ol |
|---|---|
| PubChem CID | 58820959 |
| Molecular Formula | C17H21F9O2 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-(2,3,3-trifluorobutan-2-yloxy)-1-adamantyl]propan-2-ol |
| SMILES | CC(F)(F)C(C)(F)OC12CC3CC(C1)CC(C(O)(C(F)(F)F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C17H21F9O2/c1-11(18,19)12(2,20)28-14-6-9-3-10(7-14)5-13(4-9,8-14)15(27,16(21,22)23)17(24,25)26/h9-10,27H,3-8H2,1-2H3 |
| InChIKey | UHVSCUTYCMSIMU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |