C24H37F3O5 — CID 134444073
[3-[2-(3,3,3-trifluoropropanoyloxy)ethoxy]-1-adamantyl] 2-ethyl-2,3,3-trimethylbutanoate (PubChem CID 134444073) has the molecular formula C24H37F3O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is [3-[2-(3,3,3-trifluoropropanoyloxy)ethoxy]-1-adamantyl] 2-ethyl-2,3,3-trimethylbutanoate.
| Compound Name | [3-[2-(3,3,3-trifluoropropanoyloxy)ethoxy]-1-adamantyl] 2-ethyl-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 134444073 |
| Molecular Formula | C24H37F3O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [3-[2-(3,3,3-trifluoropropanoyloxy)ethoxy]-1-adamantyl] 2-ethyl-2,3,3-trimethylbutanoate |
| SMILES | CCC(C)(C(=O)OC12CC3CC(CC(OCCOC(=O)CC(F)(F)F)(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C24H37F3O5/c1-6-21(5,20(2,3)4)19(29)32-23-12-16-9-17(13-23)11-22(10-16,15-23)31-8-7-30-18(28)14-24(25,26)27/h16-17H,6-15H2,1-5H3 |
| InChIKey | IOYSPCSLTSYMMX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|