C55H84O9 — CID 159019710
(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2-methylbutanoate (PubChem CID 159019710) has the molecular formula C55H84O9 and a molecular weight of 889.27 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2-methylbutanoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 159019710 |
| Molecular Formula | C55H84O9 |
| Molecular Weight | 889.27 g/mol |
| Exact Mass | 888.61 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2,2-dimethylbutanoate;(6-hydroxy-1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl) 2-methylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2.CCC(C)(C)C(=O)OC12CC3CC4C1CC1CC2C(C3)C4(O)C1.CCC(C)C(=O)OC12CC3CC4C1CC1CC2C(C3)C4(O)C1 |
| InChI | InChI=1S/C20H30O3.C19H28O3.C16H26O3/c1-4-18(2,3)17(21)23-20-10-12-5-13-15(20)7-11-8-16(20)14(6-12)19(13,22)9-11;1-3-10(2)17(20)22-19-9-12-4-13-15(19)6-11-7-16(19)14(5-12)18(13,21)8-11;1-4-14(2,3)13(17)19-16-8-11-5-12(9-16)7-15(18,6-11)10-16/h11-16,22H,4-10H2,1-3H3;10-16,21H,3-9H2,1-2H3;11-12,18H,4-10H2,1-3H3 |
| InChIKey | JTNMPOQNVWDPIL-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.27 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|