C19H24F6O7S3 — CID 118265580
2-[5,5-bis(hydroxymethyl)spiro[1,3-dithiane-2,4'-adamantane]-1'-yl]oxycarbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 118265580) has the molecular formula C19H24F6O7S3 and a molecular weight of 574.58 g/mol. Its IUPAC name is 2-[5,5-bis(hydroxymethyl)spiro[1,3-dithiane-2,4'-adamantane]-1'-yl]oxycarbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 2-[5,5-bis(hydroxymethyl)spiro[1,3-dithiane-2,4'-adamantane]-1'-yl]oxycarbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 118265580 |
| Molecular Formula | C19H24F6O7S3 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | 2-[5,5-bis(hydroxymethyl)spiro[1,3-dithiane-2,4'-adamantane]-1'-yl]oxycarbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | O=C(OC12CC3CC(C1)C1(SCC(CO)(CO)CS1)C(C3)C2)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C19H24F6O7S3/c20-18(21,22)17(19(23,24)25,35(29,30)31)13(28)32-15-3-10-1-11(4-15)16(12(2-10)5-15)33-8-14(6-26,7-27)9-34-16/h10-12,26-27H,1-9H2,(H,29,30,31) |
| InChIKey | VPTGWZBHYQGKOP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|