C18H19F7O9S — CID 118265112
1,1,1,2-tetrafluoro-3-oxo-3-[4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]oxypropane-2-sulfonic acid (PubChem CID 118265112) has the molecular formula C18H19F7O9S and a molecular weight of 544.39 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-oxo-3-[4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]oxypropane-2-sulfonic acid.
| Compound Name | 1,1,1,2-tetrafluoro-3-oxo-3-[4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]oxypropane-2-sulfonic acid |
|---|---|
| PubChem CID | 118265112 |
| Molecular Formula | C18H19F7O9S |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-oxo-3-[4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl]oxypropane-2-sulfonic acid |
| SMILES | O=C(OCC1COC2(O1)C1CC3CC2CC(OC(=O)C(F)(C(F)(F)F)S(=O)(=O)O)(C3)C1)C(F)(F)F |
| InChI | InChI=1S/C18H19F7O9S/c19-16(18(23,24)25,35(28,29)30)12(26)34-14-3-8-1-9(4-14)15(10(2-8)5-14)32-7-11(33-15)6-31-13(27)17(20,21)22/h8-11H,1-7H2,(H,28,29,30) |
| InChIKey | WLTAVNNZAGGWBH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|