C14H16F6O6S — CID 87141576
2,3,3,4,4,4-hexafluoro-1-[(1-hydroxy-2-adamantyl)oxy]-1-oxobutane-2-sulfonic acid (PubChem CID 87141576) has the molecular formula C14H16F6O6S and a molecular weight of 426.33 g/mol. Its IUPAC name is 2,3,3,4,4,4-hexafluoro-1-[(1-hydroxy-2-adamantyl)oxy]-1-oxobutane-2-sulfonic acid.
| Compound Name | 2,3,3,4,4,4-hexafluoro-1-[(1-hydroxy-2-adamantyl)oxy]-1-oxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 87141576 |
| Molecular Formula | C14H16F6O6S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2,3,3,4,4,4-hexafluoro-1-[(1-hydroxy-2-adamantyl)oxy]-1-oxobutane-2-sulfonic acid |
| SMILES | O=C(OC1C2CC3CC(C2)CC1(O)C3)C(F)(C(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C14H16F6O6S/c15-12(27(23,24)25,13(16,17)14(18,19)20)10(21)26-9-8-2-6-1-7(3-8)5-11(9,22)4-6/h6-9,22H,1-5H2,(H,23,24,25) |
| InChIKey | BCNVXWZOPSSSEQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|