C13H14F2O7S — CID 59814343
[2-oxo-2-(3-phenylpropoxy)ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 59814343) has the molecular formula C13H14F2O7S and a molecular weight of 352.31 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropoxy)ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | [2-oxo-2-(3-phenylpropoxy)ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 59814343 |
| Molecular Formula | C13H14F2O7S |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | [2-oxo-2-(3-phenylpropoxy)ethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | O=C(COC(=O)C(F)(F)SOOO)OCCCc1ccccc1 |
| InChI | InChI=1S/C13H14F2O7S/c14-13(15,23-22-21-18)12(17)20-9-11(16)19-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,18H,4,7-9H2 |
| InChIKey | QHCQUJQUJKBUCJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|