C14H6ClF15O3 — CID 58105966
2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-chloroacetate (PubChem CID 58105966) has the molecular formula C14H6ClF15O3 and a molecular weight of 542.62 g/mol. Its IUPAC name is 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-chloroacetate.
| Compound Name | 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-chloroacetate |
|---|---|
| PubChem CID | 58105966 |
| Molecular Formula | C14H6ClF15O3 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-chloroacetate |
| SMILES | O=C(CCl)OCCOC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C14H6ClF15O3/c15-3-4(31)32-1-2-33-8-12(25,26)5(16)9(19,20)6(17,13(8,27)28)11(23,24)7(18,10(5,21)22)14(8,29)30/h1-3H2 |
| InChIKey | GMVZBEQYVFGYME-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|