C14H4ClF15O4 — CID 58106028
(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(2-chloroacetyl)oxyacetate (PubChem CID 58106028) has the molecular formula C14H4ClF15O4 and a molecular weight of 556.61 g/mol. Its IUPAC name is (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(2-chloroacetyl)oxyacetate.
| Compound Name | (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(2-chloroacetyl)oxyacetate |
|---|---|
| PubChem CID | 58106028 |
| Molecular Formula | C14H4ClF15O4 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 555.96 |
| IUPAC Name | (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(2-chloroacetyl)oxyacetate |
| SMILES | O=C(CCl)OCC(=O)OC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C14H4ClF15O4/c15-1-3(31)33-2-4(32)34-8-12(25,26)5(16)9(19,20)6(17,13(8,27)28)11(23,24)7(18,10(5,21)22)14(8,29)30/h1-2H2 |
| InChIKey | GBKLNXRTOSXBKZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|