C15H7F15O5S — CID 174606806
(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-methyl-3-methylsulfonyloxyprop-2-enoate (PubChem CID 174606806) has the molecular formula C15H7F15O5S and a molecular weight of 584.25 g/mol. Its IUPAC name is (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-methyl-3-methylsulfonyloxyprop-2-enoate.
| Compound Name | (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-methyl-3-methylsulfonyloxyprop-2-enoate |
|---|---|
| PubChem CID | 174606806 |
| Molecular Formula | C15H7F15O5S |
| Molecular Weight | 584.25 g/mol |
| Exact Mass | 583.98 |
| IUPAC Name | (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-methyl-3-methylsulfonyloxyprop-2-enoate |
| SMILES | CC(=COS(C)(=O)=O)C(=O)OC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C15H7F15O5S/c1-4(3-34-36(2,32)33)5(31)35-9-13(25,26)6(16)10(19,20)7(17,14(9,27)28)12(23,24)8(18,11(6,21)22)15(9,29)30/h3H,1-2H3 |
| InChIKey | RKBSBDXUCOSTNG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|