C7H13O7P — CID 175087282
methyl 2-methyl-3-(2-phosphonooxyethoxy)prop-2-enoate (PubChem CID 175087282) has the molecular formula C7H13O7P and a molecular weight of 240.15 g/mol. Its IUPAC name is methyl 2-methyl-3-(2-phosphonooxyethoxy)prop-2-enoate.
| Compound Name | methyl 2-methyl-3-(2-phosphonooxyethoxy)prop-2-enoate |
|---|---|
| PubChem CID | 175087282 |
| Molecular Formula | C7H13O7P |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | methyl 2-methyl-3-(2-phosphonooxyethoxy)prop-2-enoate |
| SMILES | COC(=O)C(C)=COCCOP(=O)(O)O |
| InChI | InChI=1S/C7H13O7P/c1-6(7(8)12-2)5-13-3-4-14-15(9,10)11/h5H,3-4H2,1-2H3,(H2,9,10,11) |
| InChIKey | YCPJUMCMTXUJTH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|