C8H11O8P — CID 174767724
(3-methoxy-3-oxoprop-1-en-2-yl) 2-methyl-3-phosphonooxyprop-2-enoate (PubChem CID 174767724) has the molecular formula C8H11O8P and a molecular weight of 266.14 g/mol. Its IUPAC name is (3-methoxy-3-oxoprop-1-en-2-yl) 2-methyl-3-phosphonooxyprop-2-enoate.
| Compound Name | (3-methoxy-3-oxoprop-1-en-2-yl) 2-methyl-3-phosphonooxyprop-2-enoate |
|---|---|
| PubChem CID | 174767724 |
| Molecular Formula | C8H11O8P |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | (3-methoxy-3-oxoprop-1-en-2-yl) 2-methyl-3-phosphonooxyprop-2-enoate |
| SMILES | C=C(OC(=O)C(C)=COP(=O)(O)O)C(=O)OC |
| InChI | InChI=1S/C8H11O8P/c1-5(4-15-17(11,12)13)7(9)16-6(2)8(10)14-3/h4H,2H2,1,3H3,(H2,11,12,13) |
| InChIKey | OJXZTADONYFRBV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|