C17H30O13 — CID 175100517
carbonic acid;bis(methyl 3-(2,3-dihydroxypropoxy)-2-methylprop-2-enoate) (PubChem CID 175100517) has the molecular formula C17H30O13 and a molecular weight of 442.41 g/mol. Its IUPAC name is carbonic acid;bis(methyl 3-(2,3-dihydroxypropoxy)-2-methylprop-2-enoate).
| Compound Name | carbonic acid;bis(methyl 3-(2,3-dihydroxypropoxy)-2-methylprop-2-enoate) |
|---|---|
| PubChem CID | 175100517 |
| Molecular Formula | C17H30O13 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | carbonic acid;bis(methyl 3-(2,3-dihydroxypropoxy)-2-methylprop-2-enoate) |
| SMILES | COC(=O)C(C)=COCC(O)CO.COC(=O)C(C)=COCC(O)CO.O=C(O)O |
| InChI | InChI=1S/2C8H14O5.CH2O3/c2*1-6(8(11)12-2)4-13-5-7(10)3-9;2-1(3)4/h2*4,7,9-10H,3,5H2,1-2H3;(H2,2,3,4) |
| InChIKey | PLPZAPFBMGIKMI-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|