C11H16O7 — CID 87559125
3-[3-(2-carboxyprop-1-enoxy)-2-hydroxypropoxy]-2-methylprop-2-enoic acid (PubChem CID 87559125) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is 3-[3-(2-carboxyprop-1-enoxy)-2-hydroxypropoxy]-2-methylprop-2-enoic acid.
| Compound Name | 3-[3-(2-carboxyprop-1-enoxy)-2-hydroxypropoxy]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87559125 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-[3-(2-carboxyprop-1-enoxy)-2-hydroxypropoxy]-2-methylprop-2-enoic acid |
| SMILES | CC(=COCC(O)COC=C(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16O7/c1-7(10(13)14)3-17-5-9(12)6-18-4-8(2)11(15)16/h3-4,9,12H,5-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | XBFCTLFTUJQGQA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|