About cyclopentene;3-ethoxy-2-methylprop-2-enoic acid
cyclopentene;3-ethoxy-2-methylprop-2-enoic acid (PubChem CID 175914570) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is cyclopentene;3-ethoxy-2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | cyclopentene;3-ethoxy-2-methylprop-2-enoic acid |
| PubChem CID | 175914570 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | cyclopentene;3-ethoxy-2-methylprop-2-enoic acid |
| SMILES | C1=CCCC1.C1=CCCC1.CCOC=C(C)C(=O)O |
| InChI | InChI=1S/C6H10O3.2C5H8/c1-3-9-4-5(2)6(7)8;2*1-2-4-5-3-1/h4H,3H2,1-2H3,(H,7,8);2*1-2H,3-5H2 |
| InChIKey | NETSSWKMRJYRFB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopentene;3-ethoxy-2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentene;3-ethoxy-2-methylprop-2-enoic acid?
The IUPAC name of cyclopentene;3-ethoxy-2-methylprop-2-enoic acid (CID 175914570) is cyclopentene;3-ethoxy-2-methylprop-2-enoic acid.
What is the SMILES notation for cyclopentene;3-ethoxy-2-methylprop-2-enoic acid?
The canonical SMILES for cyclopentene;3-ethoxy-2-methylprop-2-enoic acid is C1=CCCC1.C1=CCCC1.CCOC=C(C)C(=O)O.
What is the InChIKey of cyclopentene;3-ethoxy-2-methylprop-2-enoic acid?
The InChIKey is NETSSWKMRJYRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.2C5H8/c1-3-9-4-5(2)6(7)8;2*1-2-4-5-3-1/h4H,3H2,1-2H3,(H,7,8);2*1-2H,3-5H2.
What are the key properties of cyclopentene;3-ethoxy-2-methylprop-2-enoic acid?
cyclopentene;3-ethoxy-2-methylprop-2-enoic acid has a molecular weight of 266.38 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentene;3-ethoxy-2-methylprop-2-enoic acid is sourced from PubChem (CID 175914570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).