About methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid
methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid (PubChem CID 87773746) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid |
| PubChem CID | 87773746 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid |
| SMILES | COC=C(C)C(=O)O.[C-]#[NH+] |
| InChI | InChI=1S/C5H8O3.CHN/c1-4(3-8-2)5(6)7;1-2/h3H,1-2H3,(H,6,7);2H |
| InChIKey | IHQXFKPYNGPKCM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 70.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid?
The IUPAC name of methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid (CID 87773746) is methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid.
What is the SMILES notation for methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid?
The canonical SMILES for methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid is COC=C(C)C(=O)O.[C-]#[NH+].
What is the InChIKey of methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid?
The InChIKey is IHQXFKPYNGPKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.CHN/c1-4(3-8-2)5(6)7;1-2/h3H,1-2H3,(H,6,7);2H.
What are the key properties of methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid?
methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid has a molecular weight of 143.14 g/mol, XLogP of -1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanidylidyneazanium;3-methoxy-2-methylprop-2-enoic acid is sourced from PubChem (CID 87773746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).